C11H16N2O6 — CID 161161665
1,6-diisocyanatohexane;propanedioic acid (PubChem CID 161161665) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is 1,6-diisocyanatohexane;propanedioic acid.
| Compound Name | 1,6-diisocyanatohexane;propanedioic acid |
|---|---|
| PubChem CID | 161161665 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1,6-diisocyanatohexane;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.O=C=NCCCCCCN=C=O |
| InChI | InChI=1S/C8H12N2O2.C3H4O4/c11-7-9-5-3-1-2-4-6-10-8-12;4-2(5)1-3(6)7/h1-6H2;1H2,(H,4,5)(H,6,7) |
| InChIKey | UPZRGCVQYPSPDX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|