C23H28N2O4S — CID 161161841
1-[(7S)-2,3-dimethoxy-1-methyl-9-oxo-10-(sulfanylmethyl)-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-ethylurea (PubChem CID 161161841) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 1-[(7S)-2,3-dimethoxy-1-methyl-9-oxo-10-(sulfanylmethyl)-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-ethylurea.
| Compound Name | 1-[(7S)-2,3-dimethoxy-1-methyl-9-oxo-10-(sulfanylmethyl)-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-ethylurea |
|---|---|
| PubChem CID | 161161841 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[(7S)-2,3-dimethoxy-1-methyl-9-oxo-10-(sulfanylmethyl)-6,7-dihydro-5H-benzo[a]heptalen-7-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@H]1CCc2cc(OC)c(OC)c(C)c2-c2ccc(CS)c(=O)cc21 |
| InChI | InChI=1S/C23H28N2O4S/c1-5-24-23(27)25-18-9-7-14-10-20(28-3)22(29-4)13(2)21(14)16-8-6-15(12-30)19(26)11-17(16)18/h6,8,10-11,18,30H,5,7,9,12H2,1-4H3,(H2,24,25,27)/t18-/m0/s1 |
| InChIKey | KZTSFPBPCDAJKB-SFHVURJKSA-N |
| XLogP | 3.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|