About 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine
2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine (PubChem CID 161163081) has the molecular formula C25H27Br2NO3
and a molecular weight of 549.30 g/mol. Its IUPAC name is 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine.
Molecular Properties
| Compound Name | 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine |
| PubChem CID | 161163081 |
| Molecular Formula | C25H27Br2NO3 |
| Molecular Weight | 549.30 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine |
| SMILES | C#CCCC(=O)Cc1ccc(CBr)cc1.C#CCN.O=C(O)Cc1ccc(CBr)cc1 |
| InChI | InChI=1S/C13H13BrO.C9H9BrO2.C3H5N/c1-2-3-4-13(15)9-11-5-7-12(10-14)8-6-11;10-6-8-3-1-7(2-4-8)5-9(11)12;1-2-3-4/h1,5-8H,3-4,9-10H2;1-4H,5-6H2,(H,11,12);1H,3-4H2 |
| InChIKey | UQEGPXFZLYLXTE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 549.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine?
The IUPAC name of 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine (CID 161163081) is 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine.
What is the SMILES notation for 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine?
The canonical SMILES for 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine is C#CCCC(=O)Cc1ccc(CBr)cc1.C#CCN.O=C(O)Cc1ccc(CBr)cc1.
What is the InChIKey of 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine?
The InChIKey is UQEGPXFZLYLXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO.C9H9BrO2.C3H5N/c1-2-3-4-13(15)9-11-5-7-12(10-14)8-6-11;10-6-8-3-1-7(2-4-8)5-9(11)12;1-2-3-4/h1,5-8H,3-4,9-10H2;1-4H,5-6H2,(H,11,12);1H,3-4H2.
What are the key properties of 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine?
2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine has a molecular weight of 549.30 g/mol, XLogP of 4.89, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(bromomethyl)phenyl]acetic acid;1-[4-(bromomethyl)phenyl]hex-5-yn-2-one;prop-2-yn-1-amine is sourced from PubChem (CID 161163081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).