About 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine
5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine (PubChem CID 161163437) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine |
| PubChem CID | 161163437 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine |
| SMILES | Fc1cccc(F)c1CC1CNCO1 |
| InChI | InChI=1S/C10H11F2NO/c11-9-2-1-3-10(12)8(9)4-7-5-13-6-14-7/h1-3,7,13H,4-6H2 |
| InChIKey | UQFJUJBONZBHEN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine?
The IUPAC name of 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine (CID 161163437) is 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine.
What is the SMILES notation for 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine?
The canonical SMILES for 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine is Fc1cccc(F)c1CC1CNCO1.
What is the InChIKey of 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine?
The InChIKey is UQFJUJBONZBHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO/c11-9-2-1-3-10(12)8(9)4-7-5-13-6-14-7/h1-3,7,13H,4-6H2.
What are the key properties of 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine?
5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine has a molecular weight of 199.20 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,6-difluorophenyl)methyl]-1,3-oxazolidine is sourced from PubChem (CID 161163437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).