About molecular iodine;2-(oxiran-2-ylmethyl)oxirane
molecular iodine;2-(oxiran-2-ylmethyl)oxirane (PubChem CID 161164206) has the molecular formula C5H8I2O2
and a molecular weight of 353.93 g/mol. Its IUPAC name is molecular iodine;2-(oxiran-2-ylmethyl)oxirane.
Molecular Properties
| Compound Name | molecular iodine;2-(oxiran-2-ylmethyl)oxirane |
| PubChem CID | 161164206 |
| Molecular Formula | C5H8I2O2 |
| Molecular Weight | 353.93 g/mol |
| Exact Mass | 353.86 |
| IUPAC Name | molecular iodine;2-(oxiran-2-ylmethyl)oxirane |
| SMILES | C1OC1CC1CO1.II |
| InChI | InChI=1S/C5H8O2.I2/c1(4-2-6-4)5-3-7-5;1-2/h4-5H,1-3H2; |
| InChIKey | UQHUAEKTRHXMNF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.93 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze molecular iodine;2-(oxiran-2-ylmethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular iodine;2-(oxiran-2-ylmethyl)oxirane?
The IUPAC name of molecular iodine;2-(oxiran-2-ylmethyl)oxirane (CID 161164206) is molecular iodine;2-(oxiran-2-ylmethyl)oxirane.
What is the SMILES notation for molecular iodine;2-(oxiran-2-ylmethyl)oxirane?
The canonical SMILES for molecular iodine;2-(oxiran-2-ylmethyl)oxirane is C1OC1CC1CO1.II.
What is the InChIKey of molecular iodine;2-(oxiran-2-ylmethyl)oxirane?
The InChIKey is UQHUAEKTRHXMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.I2/c1(4-2-6-4)5-3-7-5;1-2/h4-5H,1-3H2;.
What are the key properties of molecular iodine;2-(oxiran-2-ylmethyl)oxirane?
molecular iodine;2-(oxiran-2-ylmethyl)oxirane has a molecular weight of 353.93 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;2-(oxiran-2-ylmethyl)oxirane is sourced from PubChem (CID 161164206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).