C44H78O6 — CID 161165200
methyl 8-[4-(2-acetyloxyoctyl)cyclobut-2-en-1-yl]octanoate;methyl 8-(4-octylcyclobut-2-en-1-yl)octanoate (PubChem CID 161165200) has the molecular formula C44H78O6 and a molecular weight of 703.10 g/mol. Its IUPAC name is methyl 8-[4-(2-acetyloxyoctyl)cyclobut-2-en-1-yl]octanoate;methyl 8-(4-octylcyclobut-2-en-1-yl)octanoate.
| Compound Name | methyl 8-[4-(2-acetyloxyoctyl)cyclobut-2-en-1-yl]octanoate;methyl 8-(4-octylcyclobut-2-en-1-yl)octanoate |
|---|---|
| PubChem CID | 161165200 |
| Molecular Formula | C44H78O6 |
| Molecular Weight | 703.10 g/mol |
| Exact Mass | 702.58 |
| IUPAC Name | methyl 8-[4-(2-acetyloxyoctyl)cyclobut-2-en-1-yl]octanoate;methyl 8-(4-octylcyclobut-2-en-1-yl)octanoate |
| SMILES | CCCCCCC(CC1C=CC1CCCCCCCC(=O)OC)OC(C)=O.CCCCCCCCC1C=CC1CCCCCCCC(=O)OC |
| InChI | InChI=1S/C23H40O4.C21H38O2/c1-4-5-6-11-14-22(27-19(2)24)18-21-17-16-20(21)13-10-8-7-9-12-15-23(25)26-3;1-3-4-5-6-8-11-14-19-17-18-20(19)15-12-9-7-10-13-16-21(22)23-2/h16-17,20-22H,4-15,18H2,1-3H3;17-20H,3-16H2,1-2H3 |
| InChIKey | UQKYJHVTTSAMHH-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.10 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|