About methane;5-methyl-2H-tetrazole;propan-2-one
methane;5-methyl-2H-tetrazole;propan-2-one (PubChem CID 161165743) has the molecular formula C6H14N4O
and a molecular weight of 158.20 g/mol. Its IUPAC name is methane;5-methyl-2H-tetrazole;propan-2-one.
Molecular Properties
| Compound Name | methane;5-methyl-2H-tetrazole;propan-2-one |
| PubChem CID | 161165743 |
| Molecular Formula | C6H14N4O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | methane;5-methyl-2H-tetrazole;propan-2-one |
| SMILES | C.CC(C)=O.Cc1nn[nH]n1 |
| InChI | InChI=1S/C3H6O.C2H4N4.CH4/c1-3(2)4;1-2-3-5-6-4-2;/h1-2H3;1H3,(H,3,4,5,6);1H4 |
| InChIKey | UQMYNTLKYRYLPO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;5-methyl-2H-tetrazole;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-methyl-2H-tetrazole;propan-2-one?
The IUPAC name of methane;5-methyl-2H-tetrazole;propan-2-one (CID 161165743) is methane;5-methyl-2H-tetrazole;propan-2-one.
What is the SMILES notation for methane;5-methyl-2H-tetrazole;propan-2-one?
The canonical SMILES for methane;5-methyl-2H-tetrazole;propan-2-one is C.CC(C)=O.Cc1nn[nH]n1.
What is the InChIKey of methane;5-methyl-2H-tetrazole;propan-2-one?
The InChIKey is UQMYNTLKYRYLPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H4N4.CH4/c1-3(2)4;1-2-3-5-6-4-2;/h1-2H3;1H3,(H,3,4,5,6);1H4.
What are the key properties of methane;5-methyl-2H-tetrazole;propan-2-one?
methane;5-methyl-2H-tetrazole;propan-2-one has a molecular weight of 158.20 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-methyl-2H-tetrazole;propan-2-one is sourced from PubChem (CID 161165743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).