About tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride
tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride (PubChem CID 161166087) has the molecular formula C19H39ClN2O2
and a molecular weight of 362.99 g/mol. Its IUPAC name is tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride |
| PubChem CID | 161166087 |
| Molecular Formula | C19H39ClN2O2 |
| Molecular Weight | 362.99 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride |
| SMILES | CCC1CCN(C(=O)OC(C)(C)C)CC1.CCC1CCNCC1.Cl |
| InChI | InChI=1S/C12H23NO2.C7H15N.ClH/c1-5-10-6-8-13(9-7-10)11(14)15-12(2,3)4;1-2-7-3-5-8-6-4-7;/h10H,5-9H2,1-4H3;7-8H,2-6H2,1H3;1H |
| InChIKey | NJEFMNPTALYBPG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride?
The IUPAC name of tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride (CID 161166087) is tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride.
What is the SMILES notation for tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride?
The canonical SMILES for tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride is CCC1CCN(C(=O)OC(C)(C)C)CC1.CCC1CCNCC1.Cl.
What is the InChIKey of tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride?
The InChIKey is NJEFMNPTALYBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2.C7H15N.ClH/c1-5-10-6-8-13(9-7-10)11(14)15-12(2,3)4;1-2-7-3-5-8-6-4-7;/h10H,5-9H2,1-4H3;7-8H,2-6H2,1H3;1H.
What are the key properties of tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride?
tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride has a molecular weight of 362.99 g/mol, XLogP of 4.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-ethylpiperidine-1-carboxylate;4-ethylpiperidine;hydrochloride is sourced from PubChem (CID 161166087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).