C27H29FO4 — CID 161166473
(2S,3R,4R,5R,6S)-2-[3-(3-fluorophenyl)-4-propylphenoxy]-5-methyl-6-phenyloxane-3,4-diol (PubChem CID 161166473) has the molecular formula C27H29FO4 and a molecular weight of 436.52 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[3-(3-fluorophenyl)-4-propylphenoxy]-5-methyl-6-phenyloxane-3,4-diol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[3-(3-fluorophenyl)-4-propylphenoxy]-5-methyl-6-phenyloxane-3,4-diol |
|---|---|
| PubChem CID | 161166473 |
| Molecular Formula | C27H29FO4 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[3-(3-fluorophenyl)-4-propylphenoxy]-5-methyl-6-phenyloxane-3,4-diol |
| SMILES | CCCc1ccc(O[C@@H]2O[C@H](c3ccccc3)[C@H](C)[C@@H](O)[C@H]2O)cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C27H29FO4/c1-3-8-18-13-14-22(16-23(18)20-11-7-12-21(28)15-20)31-27-25(30)24(29)17(2)26(32-27)19-9-5-4-6-10-19/h4-7,9-17,24-27,29-30H,3,8H2,1-2H3/t17-,24-,25-,26+,27-/m1/s1 |
| InChIKey | GNCAGVNVLVSHTN-ROYCKKHXSA-N |
| XLogP | 5.28 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |