C44H72O6 — CID 161166810
[1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentan-2-yl] acetate;[1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentyl] acetate (PubChem CID 161166810) has the molecular formula C44H72O6 and a molecular weight of 697.05 g/mol. Its IUPAC name is [1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentan-2-yl] acetate;[1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentyl] acetate.
| Compound Name | [1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentan-2-yl] acetate;[1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentyl] acetate |
|---|---|
| PubChem CID | 161166810 |
| Molecular Formula | C44H72O6 |
| Molecular Weight | 697.05 g/mol |
| Exact Mass | 696.53 |
| IUPAC Name | [1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentan-2-yl] acetate;[1-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-5-methoxypentyl] acetate |
| SMILES | COCCCC(CC1CC2CC1C1C3CC(C(C)C3C)C21)OC(C)=O.COCCCCC(OC(C)=O)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/2C22H36O3/c1-12-13(2)19-11-18(12)21-16-8-15(20(10-16)22(19)21)9-17(25-14(3)23)6-5-7-24-4;1-12-13(2)17-11-16(12)21-15-9-18(19(10-15)22(17)21)20(25-14(3)23)7-5-6-8-24-4/h2*12-13,15-22H,5-11H2,1-4H3 |
| InChIKey | UQQNQLBKYVGWIF-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.05 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|