About 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate
2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate (PubChem CID 161167956) has the molecular formula C16H18BrF3O3S
and a molecular weight of 427.28 g/mol. Its IUPAC name is 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate.
Molecular Properties
| Compound Name | 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate |
| PubChem CID | 161167956 |
| Molecular Formula | C16H18BrF3O3S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate |
| SMILES | FC(F)(F)[s+]1c(C2CCCCCC2)cc2ccccc21.[O-][Br+2]([O-])[O-] |
| InChI | InChI=1S/C16H18F3S.BrO3/c17-16(18,19)20-14-10-6-5-9-13(14)11-15(20)12-7-3-1-2-4-8-12;2-1(3)4/h5-6,9-12H,1-4,7-8H2;/q+1;-1 |
| InChIKey | UQUMZSUCVVGVOE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate?
The IUPAC name of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate (CID 161167956) is 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate.
What is the SMILES notation for 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate?
The canonical SMILES for 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate is FC(F)(F)[s+]1c(C2CCCCCC2)cc2ccccc21.[O-][Br+2]([O-])[O-].
What is the InChIKey of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate?
The InChIKey is UQUMZSUCVVGVOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3S.BrO3/c17-16(18,19)20-14-10-6-5-9-13(14)11-15(20)12-7-3-1-2-4-8-12;2-1(3)4/h5-6,9-12H,1-4,7-8H2;/q+1;-1.
What are the key properties of 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate?
2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate has a molecular weight of 427.28 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-1-(trifluoromethyl)-1-benzothiophen-1-ium bromate is sourced from PubChem (CID 161167956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).