C20H29BiN4O10S — CID 161171179
bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-N'-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 161171179) has the molecular formula C20H29BiN4O10S and a molecular weight of 726.52 g/mol. Its IUPAC name is bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-N'-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-N'-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 161171179 |
| Molecular Formula | C20H29BiN4O10S |
| Molecular Weight | 726.52 g/mol |
| Exact Mass | 726.14 |
| IUPAC Name | bismuth;1-N'-[2-[[5-[(dimethylamino)methyl]-4-methylfuran-2-yl]methylsulfanyl]ethyl]-1-N'-methyl-2-nitroethene-1,1-diamine;2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | Cc1cc(CSCCN(C)C(N)=C[N+](=O)[O-])oc1CN(C)C.O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Bi+3] |
| InChI | InChI=1S/C14H24N4O3S.C6H8O7.Bi/c1-11-7-12(21-13(11)8-16(2)3)10-22-6-5-17(4)14(15)9-18(19)20;7-3(8)1-6(13,5(11)12)2-4(9)10;/h7,9H,5-6,8,10,15H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;;+3/p-3 |
| InChIKey | URESBRCUGFLQHA-UHFFFAOYSA-K |
| XLogP | -3.78 |
| TPSA | 229.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.52 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|