About piperazine;quinoline;hydrochloride
piperazine;quinoline;hydrochloride (PubChem CID 161171284) has the molecular formula C13H18ClN3
and a molecular weight of 251.76 g/mol. Its IUPAC name is piperazine;quinoline;hydrochloride.
Molecular Properties
| Compound Name | piperazine;quinoline;hydrochloride |
| PubChem CID | 161171284 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | piperazine;quinoline;hydrochloride |
| SMILES | C1CNCCN1.Cl.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C4H10N2.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-6-4-3-5-1;/h1-7H;5-6H,1-4H2;1H |
| InChIKey | URFBJSKLANOEQM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperazine;quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;quinoline;hydrochloride?
The IUPAC name of piperazine;quinoline;hydrochloride (CID 161171284) is piperazine;quinoline;hydrochloride.
What is the SMILES notation for piperazine;quinoline;hydrochloride?
The canonical SMILES for piperazine;quinoline;hydrochloride is C1CNCCN1.Cl.c1ccc2ncccc2c1.
What is the InChIKey of piperazine;quinoline;hydrochloride?
The InChIKey is URFBJSKLANOEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C4H10N2.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-6-4-3-5-1;/h1-7H;5-6H,1-4H2;1H.
What are the key properties of piperazine;quinoline;hydrochloride?
piperazine;quinoline;hydrochloride has a molecular weight of 251.76 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;quinoline;hydrochloride is sourced from PubChem (CID 161171284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).