C16H16F2N4O4 — CID 161172413
4-amino-2-fluoro-N-(trideuteriomethyl)benzamide;2-fluoro-4-nitro-N-(trideuteriomethyl)benzamide (PubChem CID 161172413) has the molecular formula C16H16F2N4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is 4-amino-2-fluoro-N-(trideuteriomethyl)benzamide;2-fluoro-4-nitro-N-(trideuteriomethyl)benzamide.
| Compound Name | 4-amino-2-fluoro-N-(trideuteriomethyl)benzamide;2-fluoro-4-nitro-N-(trideuteriomethyl)benzamide |
|---|---|
| PubChem CID | 161172413 |
| Molecular Formula | C16H16F2N4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-amino-2-fluoro-N-(trideuteriomethyl)benzamide;2-fluoro-4-nitro-N-(trideuteriomethyl)benzamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1ccc(N)cc1F.[2H]C([2H])([2H])NC(=O)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C8H7FN2O3.C8H9FN2O/c1-10-8(12)6-3-2-5(11(13)14)4-7(6)9;1-11-8(12)6-3-2-5(10)4-7(6)9/h2-4H,1H3,(H,10,12);2-4H,10H2,1H3,(H,11,12)/i2*1D3 |
| InChIKey | URIZKKAUUFZWEC-RVWRRERJSA-N |
| XLogP | 1.86 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|