About CID 161173679
CID 161173679 (PubChem CID 161173679) has the molecular formula C8H12Li
and a molecular weight of 115.12 g/mol.
Molecular Properties
| Compound Name | CID 161173679 |
| PubChem CID | 161173679 |
| Molecular Formula | C8H12Li |
| Molecular Weight | 115.12 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | — |
| SMILES | CCC1=C(C)CC=C1.[Li] |
| InChI | InChI=1S/C8H12.Li/c1-3-8-6-4-5-7(8)2;/h4,6H,3,5H2,1-2H3; |
| InChIKey | URNDMDKUIBGOAO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 161173679 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161173679?
The IUPAC name of CID 161173679 (CID 161173679) is not available.
What is the SMILES notation for CID 161173679?
The canonical SMILES for CID 161173679 is CCC1=C(C)CC=C1.[Li].
What is the InChIKey of CID 161173679?
The InChIKey is URNDMDKUIBGOAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.Li/c1-3-8-6-4-5-7(8)2;/h4,6H,3,5H2,1-2H3;.
What are the key properties of CID 161173679?
CID 161173679 has a molecular weight of 115.12 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161173679 is sourced from PubChem (CID 161173679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).