About bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium
bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium (PubChem CID 161173932) has the molecular formula C26H26O2S
and a molecular weight of 402.56 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium |
| PubChem CID | 161173932 |
| Molecular Formula | C26H26O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium |
| SMILES | O=C([O-])C1CC2CCC1C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H12O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-8(10)7-4-5-1-2-6(7)3-5/h1-15H;5-7H,1-4H2,(H,9,10)/q+1;/p-1 |
| InChIKey | URNXXXADGYJEEG-UHFFFAOYSA-M |
| XLogP | 4.95 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
The IUPAC name of bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium (CID 161173932) is bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium.
What is the SMILES notation for bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
The canonical SMILES for bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium is O=C([O-])C1CC2CCC1C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
The InChIKey is URNXXXADGYJEEG-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C8H12O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-8(10)7-4-5-1-2-6(7)3-5/h1-15H;5-7H,1-4H2,(H,9,10)/q+1;/p-1.
What are the key properties of bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium?
bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium has a molecular weight of 402.56 g/mol, XLogP of 4.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium is sourced from PubChem (CID 161173932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).