About pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine
pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine (PubChem CID 161175080) has the molecular formula C14H31N5
and a molecular weight of 269.44 g/mol. Its IUPAC name is pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine |
| PubChem CID | 161175080 |
| Molecular Formula | C14H31N5 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.26 |
| IUPAC Name | pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine |
| SMILES | CCCCCC1(N)C=CNC(N)=N1.CCCCCN |
| InChI | InChI=1S/C9H18N4.C5H13N/c1-2-3-4-5-9(11)6-7-12-8(10)13-9;1-2-3-4-5-6/h6-7H,2-5,11H2,1H3,(H3,10,12,13);2-6H2,1H3 |
| InChIKey | URRROGMKMSXAHN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine?
The IUPAC name of pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine (CID 161175080) is pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine.
What is the SMILES notation for pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine?
The canonical SMILES for pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine is CCCCCC1(N)C=CNC(N)=N1.CCCCCN.
What is the InChIKey of pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine?
The InChIKey is URRROGMKMSXAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4.C5H13N/c1-2-3-4-5-9(11)6-7-12-8(10)13-9;1-2-3-4-5-6/h6-7H,2-5,11H2,1H3,(H3,10,12,13);2-6H2,1H3.
What are the key properties of pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine?
pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine has a molecular weight of 269.44 g/mol, XLogP of 1.79, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-1-amine;4-pentyl-1H-pyrimidine-2,4-diamine is sourced from PubChem (CID 161175080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).