About N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine
N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine (PubChem CID 161175310) has the molecular formula C21H44N2O2
and a molecular weight of 356.60 g/mol. Its IUPAC name is N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine.
Molecular Properties
| Compound Name | N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine |
| PubChem CID | 161175310 |
| Molecular Formula | C21H44N2O2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine |
| SMILES | CC(C)(C)CCCCOCCOCCN1CCC(NC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H44N2O2/c1-20(2,3)11-7-8-15-24-17-18-25-16-14-23-12-9-19(10-13-23)22-21(4,5)6/h19,22H,7-18H2,1-6H3 |
| InChIKey | URSMAQSLYOAEIP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine?
The IUPAC name of N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine (CID 161175310) is N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine.
What is the SMILES notation for N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine?
The canonical SMILES for N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine is CC(C)(C)CCCCOCCOCCN1CCC(NC(C)(C)C)CC1.
What is the InChIKey of N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine?
The InChIKey is URSMAQSLYOAEIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44N2O2/c1-20(2,3)11-7-8-15-24-17-18-25-16-14-23-12-9-19(10-13-23)22-21(4,5)6/h19,22H,7-18H2,1-6H3.
What are the key properties of N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine?
N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine has a molecular weight of 356.60 g/mol, XLogP of 4.09, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethyl]piperidin-4-amine is sourced from PubChem (CID 161175310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).