About 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene
2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene (PubChem CID 161175478) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene.
Molecular Properties
| Compound Name | 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene |
| PubChem CID | 161175478 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene |
| SMILES | C=CC.CCC1(C)OCC(COC)O1 |
| InChI | InChI=1S/C8H16O3.C3H6/c1-4-8(2)10-6-7(11-8)5-9-3;1-3-2/h7H,4-6H2,1-3H3;3H,1H2,2H3 |
| InChIKey | URTBEOWYTVDREV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene?
The IUPAC name of 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene (CID 161175478) is 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene.
What is the SMILES notation for 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene?
The canonical SMILES for 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene is C=CC.CCC1(C)OCC(COC)O1.
What is the InChIKey of 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene?
The InChIKey is URTBEOWYTVDREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3.C3H6/c1-4-8(2)10-6-7(11-8)5-9-3;1-3-2/h7H,4-6H2,1-3H3;3H,1H2,2H3.
What are the key properties of 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene?
2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene has a molecular weight of 202.29 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(methoxymethyl)-2-methyl-1,3-dioxolane;prop-1-ene is sourced from PubChem (CID 161175478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).