C37H56N6O6 — CID 161175534
(2R,3S,4R,7S,13S,19S)-7-benzyl-N-tert-butyl-4,13-bis(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,5,8,14,17-pentazatricyclo[17.3.0.03,5]docosane-2-carboxamide (PubChem CID 161175534) has the molecular formula C37H56N6O6 and a molecular weight of 680.89 g/mol. Its IUPAC name is (2R,3S,4R,7S,13S,19S)-7-benzyl-N-tert-butyl-4,13-bis(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,5,8,14,17-pentazatricyclo[17.3.0.03,5]docosane-2-carboxamide.
| Compound Name | (2R,3S,4R,7S,13S,19S)-7-benzyl-N-tert-butyl-4,13-bis(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,5,8,14,17-pentazatricyclo[17.3.0.03,5]docosane-2-carboxamide |
|---|---|
| PubChem CID | 161175534 |
| Molecular Formula | C37H56N6O6 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.43 |
| IUPAC Name | (2R,3S,4R,7S,13S,19S)-7-benzyl-N-tert-butyl-4,13-bis(2-methylpropyl)-6,9,12,15,18-pentaoxo-1,5,8,14,17-pentazatricyclo[17.3.0.03,5]docosane-2-carboxamide |
| SMILES | CC(C)C[C@@H]1NC(=O)CNC(=O)[C@@H]2CCCN2[C@@H](C(=O)NC(C)(C)C)[C@@H]2[C@@H](CC(C)C)N2C(=O)[C@H](Cc2ccccc2)NC(=O)CCC1=O |
| InChI | InChI=1S/C37H56N6O6/c1-22(2)18-25-29(44)15-16-30(45)40-26(20-24-12-9-8-10-13-24)36(49)43-28(19-23(3)4)32(43)33(35(48)41-37(5,6)7)42-17-11-14-27(42)34(47)38-21-31(46)39-25/h8-10,12-13,22-23,25-28,32-33H,11,14-21H2,1-7H3,(H,38,47)(H,39,46)(H,40,45)(H,41,48)/t25-,26-,27-,28+,32-,33+,43?/m0/s1 |
| InChIKey | VLYUEOYJORNVIY-GOEDYWPYSA-N |
| XLogP | 2.10 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|