About [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride
[1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride (PubChem CID 161175679) has the molecular formula C23H27ClN2O2S
and a molecular weight of 431.00 g/mol. Its IUPAC name is [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride |
| PubChem CID | 161175679 |
| Molecular Formula | C23H27ClN2O2S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride |
| SMILES | CC(C)(CCC(C#N)(c1ccccc1)c1ccccc1)N1CC(CS(=O)(=O)Cl)C1 |
| InChI | InChI=1S/C23H27ClN2O2S/c1-22(2,26-15-19(16-26)17-29(24,27)28)13-14-23(18-25,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,19H,13-17H2,1-2H3 |
| InChIKey | URTTZBAYHDRPRS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride?
The IUPAC name of [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride (CID 161175679) is [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride.
What is the SMILES notation for [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride?
The canonical SMILES for [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride is CC(C)(CCC(C#N)(c1ccccc1)c1ccccc1)N1CC(CS(=O)(=O)Cl)C1.
What is the InChIKey of [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride?
The InChIKey is URTTZBAYHDRPRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27ClN2O2S/c1-22(2,26-15-19(16-26)17-29(24,27)28)13-14-23(18-25,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-12,19H,13-17H2,1-2H3.
What are the key properties of [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride?
[1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride has a molecular weight of 431.00 g/mol, XLogP of 4.56, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-cyano-2-methyl-5,5-diphenylpentan-2-yl)azetidin-3-yl]methanesulfonyl chloride is sourced from PubChem (CID 161175679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).