C21H37NO4 — CID 161176511
tert-butyl 3-[(2R)-2-cyclopentyloxycarbonyl-4-methylpentyl]pyrrolidine-1-carboxylate (PubChem CID 161176511) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is tert-butyl 3-[(2R)-2-cyclopentyloxycarbonyl-4-methylpentyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2R)-2-cyclopentyloxycarbonyl-4-methylpentyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 161176511 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | tert-butyl 3-[(2R)-2-cyclopentyloxycarbonyl-4-methylpentyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)C[C@H](CC1CCN(C(=O)OC(C)(C)C)C1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C21H37NO4/c1-15(2)12-17(19(23)25-18-8-6-7-9-18)13-16-10-11-22(14-16)20(24)26-21(3,4)5/h15-18H,6-14H2,1-5H3/t16?,17-/m1/s1 |
| InChIKey | JWGBGEBYSPBDRN-ZYMOGRSISA-N |
| XLogP | 4.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |