C21H36F4O9 — CID 161176762
1-but-3-enoxy-3-[2-[[2-[2-(3-but-3-enoxy-2-hydroxypropoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]propan-2-ol (PubChem CID 161176762) has the molecular formula C21H36F4O9 and a molecular weight of 508.50 g/mol. Its IUPAC name is 1-but-3-enoxy-3-[2-[[2-[2-(3-but-3-enoxy-2-hydroxypropoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]propan-2-ol.
| Compound Name | 1-but-3-enoxy-3-[2-[[2-[2-(3-but-3-enoxy-2-hydroxypropoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 161176762 |
| Molecular Formula | C21H36F4O9 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 1-but-3-enoxy-3-[2-[[2-[2-(3-but-3-enoxy-2-hydroxypropoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]propan-2-ol |
| SMILES | C=CCCOCC(O)COCCOCOCC(F)(F)OC(F)(F)COCC(O)COCCC=C |
| InChI | InChI=1S/C21H36F4O9/c1-3-5-7-28-11-18(26)13-30-9-10-31-17-33-16-21(24,25)34-20(22,23)15-32-14-19(27)12-29-8-6-4-2/h3-4,18-19,26-27H,1-2,5-17H2 |
| InChIKey | URXLLSIVJPGZCG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|