C12H18 — CID 161177189
(E)-2,3-dideuteriohex-2-en-4-yne;(2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-diene (PubChem CID 161177189) has the molecular formula C12H18 and a molecular weight of 168.31 g/mol. Its IUPAC name is (E)-2,3-dideuteriohex-2-en-4-yne;(2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-diene.
| Compound Name | (E)-2,3-dideuteriohex-2-en-4-yne;(2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-diene |
|---|---|
| PubChem CID | 161177189 |
| Molecular Formula | C12H18 |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.18 |
| IUPAC Name | (E)-2,3-dideuteriohex-2-en-4-yne;(2E,4E)-2,3,4,5-tetradeuteriohexa-2,4-diene |
| SMILES | [2H]/C(C)=C(/[2H])C#CC.[2H]/C(C)=C([2H])\C([2H])=C(/[2H])C |
| InChI | InChI=1S/C6H10.C6H8/c2*1-3-5-6-4-2/h3-6H,1-2H3;3,5H,1-2H3/b5-3+,6-4+;5-3+/i3D,4D,5D,6D;3D,5D |
| InChIKey | URYVKYXMSBYSID-VKAILEGOSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|