About fluoromethane;4-propan-2-yl-2H-pyrrole
fluoromethane;4-propan-2-yl-2H-pyrrole (PubChem CID 161177358) has the molecular formula C8H14FN
and a molecular weight of 143.20 g/mol. Its IUPAC name is fluoromethane;4-propan-2-yl-2H-pyrrole.
Molecular Properties
| Compound Name | fluoromethane;4-propan-2-yl-2H-pyrrole |
| PubChem CID | 161177358 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | fluoromethane;4-propan-2-yl-2H-pyrrole |
| SMILES | CC(C)C1=CCN=C1.CF |
| InChI | InChI=1S/C7H11N.CH3F/c1-6(2)7-3-4-8-5-7;1-2/h3,5-6H,4H2,1-2H3;1H3 |
| InChIKey | URZKGJIVSFFCAQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoromethane;4-propan-2-yl-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;4-propan-2-yl-2H-pyrrole?
The IUPAC name of fluoromethane;4-propan-2-yl-2H-pyrrole (CID 161177358) is fluoromethane;4-propan-2-yl-2H-pyrrole.
What is the SMILES notation for fluoromethane;4-propan-2-yl-2H-pyrrole?
The canonical SMILES for fluoromethane;4-propan-2-yl-2H-pyrrole is CC(C)C1=CCN=C1.CF.
What is the InChIKey of fluoromethane;4-propan-2-yl-2H-pyrrole?
The InChIKey is URZKGJIVSFFCAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.CH3F/c1-6(2)7-3-4-8-5-7;1-2/h3,5-6H,4H2,1-2H3;1H3.
What are the key properties of fluoromethane;4-propan-2-yl-2H-pyrrole?
fluoromethane;4-propan-2-yl-2H-pyrrole has a molecular weight of 143.20 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;4-propan-2-yl-2H-pyrrole is sourced from PubChem (CID 161177358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).