About 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol
11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol (PubChem CID 161177931) has the molecular formula C34H23BrO4
and a molecular weight of 575.46 g/mol. Its IUPAC name is 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol.
Molecular Properties
| Compound Name | 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol |
| PubChem CID | 161177931 |
| Molecular Formula | C34H23BrO4 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol |
| SMILES | Oc1ccc2c(c1)Cc1c-2cc2ccc(O)cc2c1Br.Oc1ccc2c(c1)Cc1cc3cc(O)ccc3cc1-2 |
| InChI | InChI=1S/C17H11BrO2.C17H12O2/c18-17-14-8-12(20)2-1-9(14)6-15-13-4-3-11(19)5-10(13)7-16(15)17;18-14-2-1-10-9-17-12(5-11(10)7-14)6-13-8-15(19)3-4-16(13)17/h1-6,8,19-20H,7H2;1-5,7-9,18-19H,6H2 |
| InChIKey | USBGSYATHHRFGA-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol?
The IUPAC name of 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol (CID 161177931) is 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol.
What is the SMILES notation for 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol?
The canonical SMILES for 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol is Oc1ccc2c(c1)Cc1c-2cc2ccc(O)cc2c1Br.Oc1ccc2c(c1)Cc1cc3cc(O)ccc3cc1-2.
What is the InChIKey of 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol?
The InChIKey is USBGSYATHHRFGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrO2.C17H12O2/c18-17-14-8-12(20)2-1-9(14)6-15-13-4-3-11(19)5-10(13)7-16(15)17;18-14-2-1-10-9-17-12(5-11(10)7-14)6-13-8-15(19)3-4-16(13)17/h1-6,8,19-20H,7H2;1-5,7-9,18-19H,6H2.
What are the key properties of 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol?
11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol has a molecular weight of 575.46 g/mol, XLogP of 8.41, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11H-benzo[b]fluorene-2,8-diol;10-bromo-11H-benzo[b]fluorene-2,8-diol is sourced from PubChem (CID 161177931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).