C26H38BBrN4O6 — CID 161178049
tert-butyl N-(5-bromo-3-pyridinyl)carbamate;tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate (PubChem CID 161178049) has the molecular formula C26H38BBrN4O6 and a molecular weight of 593.33 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-3-pyridinyl)carbamate;tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-(5-bromo-3-pyridinyl)carbamate;tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 161178049 |
| Molecular Formula | C26H38BBrN4O6 |
| Molecular Weight | 593.33 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | tert-butyl N-(5-bromo-3-pyridinyl)carbamate;tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cncc(B2OC(C)(C)C(C)(C)O2)c1.CC(C)(C)OC(=O)Nc1cncc(Br)c1 |
| InChI | InChI=1S/C16H25BN2O4.C10H13BrN2O2/c1-14(2,3)21-13(20)19-12-8-11(9-18-10-12)17-22-15(4,5)16(6,7)23-17;1-10(2,3)15-9(14)13-8-4-7(11)5-12-6-8/h8-10H,1-7H3,(H,19,20);4-6H,1-3H3,(H,13,14) |
| InChIKey | USBOXNLCEFIQJT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|