About 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene
1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene (PubChem CID 161180202) has the molecular formula C19H15BrN2O4
and a molecular weight of 415.24 g/mol. Its IUPAC name is 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene |
| PubChem CID | 161180202 |
| Molecular Formula | C19H15BrN2O4 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene |
| SMILES | Cc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1.O=[N+]([O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H11NO2.C6H4BrNO2/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14(15)16;7-5-1-3-6(4-2-5)8(9)10/h2-9H,1H3;1-4H |
| InChIKey | USIQTFMNINWKBG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene?
The IUPAC name of 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene (CID 161180202) is 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene.
What is the SMILES notation for 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene?
The canonical SMILES for 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene is Cc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1.O=[N+]([O-])c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene?
The InChIKey is USIQTFMNINWKBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO2.C6H4BrNO2/c1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14(15)16;7-5-1-3-6(4-2-5)8(9)10/h2-9H,1H3;1-4H.
What are the key properties of 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene?
1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene has a molecular weight of 415.24 g/mol, XLogP of 5.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-nitrobenzene;1-methyl-4-(4-nitrophenyl)benzene is sourced from PubChem (CID 161180202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).