C11H19N3O3S — CID 161180441
1-(3,5-diamino-2,4,6-trimethylphenyl)-1-hydroxyethanesulfonamide (PubChem CID 161180441) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-(3,5-diamino-2,4,6-trimethylphenyl)-1-hydroxyethanesulfonamide.
| Compound Name | 1-(3,5-diamino-2,4,6-trimethylphenyl)-1-hydroxyethanesulfonamide |
|---|---|
| PubChem CID | 161180441 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-(3,5-diamino-2,4,6-trimethylphenyl)-1-hydroxyethanesulfonamide |
| SMILES | Cc1c(N)c(C)c(C(C)(O)S(N)(=O)=O)c(C)c1N |
| InChI | InChI=1S/C11H19N3O3S/c1-5-8(11(4,15)18(14,16)17)6(2)10(13)7(3)9(5)12/h15H,12-13H2,1-4H3,(H2,14,16,17) |
| InChIKey | AMAUBMBRFNGEQZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|