C23H34N2O10S — CID 161180621
26-methoxy-24-nitro-17-oxo-2,5,8,14-tetraoxa-21-thia-18-azabicyclo[21.2.2]heptacosa-1(26),23(27),24-triene-19-carboxylic acid (PubChem CID 161180621) has the molecular formula C23H34N2O10S and a molecular weight of 530.60 g/mol. Its IUPAC name is 26-methoxy-24-nitro-17-oxo-2,5,8,14-tetraoxa-21-thia-18-azabicyclo[21.2.2]heptacosa-1(26),23(27),24-triene-19-carboxylic acid.
| Compound Name | 26-methoxy-24-nitro-17-oxo-2,5,8,14-tetraoxa-21-thia-18-azabicyclo[21.2.2]heptacosa-1(26),23(27),24-triene-19-carboxylic acid |
|---|---|
| PubChem CID | 161180621 |
| Molecular Formula | C23H34N2O10S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 26-methoxy-24-nitro-17-oxo-2,5,8,14-tetraoxa-21-thia-18-azabicyclo[21.2.2]heptacosa-1(26),23(27),24-triene-19-carboxylic acid |
| SMILES | COc1cc2c([N+](=O)[O-])cc1OCCOCCOCCCCCOCCC(=O)NC(C(=O)O)CSC2 |
| InChI | InChI=1S/C23H34N2O10S/c1-31-20-13-17-15-36-16-18(23(27)28)24-22(26)5-8-32-6-3-2-4-7-33-9-10-34-11-12-35-21(20)14-19(17)25(29)30/h13-14,18H,2-12,15-16H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | KGDIKIHZYMFLJW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 155.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|