C16H9ClN6O — CID 161181919
4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;7-hydroxypyrrolo[2,3-b]pyridine-3-carbonitrile (PubChem CID 161181919) has the molecular formula C16H9ClN6O and a molecular weight of 336.74 g/mol. Its IUPAC name is 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;7-hydroxypyrrolo[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;7-hydroxypyrrolo[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 161181919 |
| Molecular Formula | C16H9ClN6O |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile;7-hydroxypyrrolo[2,3-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2nccc(Cl)c12.N#Cc1cnc2n(O)cccc1-2 |
| InChI | InChI=1S/C8H4ClN3.C8H5N3O/c9-6-1-2-11-8-7(6)5(3-10)4-12-8;9-4-6-5-10-8-7(6)2-1-3-11(8)12/h1-2,4H,(H,11,12);1-3,5,12H |
| InChIKey | RKMRDOBLEZYGLC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|