C31H29F4N7O2 — CID 16118193
Aminopyrimidine amide, 18 (PubChem CID 16118193) has the molecular formula C31H29F4N7O2 and a molecular weight of 607.60 g/mol. Its IUPAC name is 5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-2-methyl-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]benzamide.
| Compound Name | Aminopyrimidine amide, 18 |
|---|---|
| PubChem CID | 16118193 |
| Molecular Formula | C31H29F4N7O2 |
| Molecular Weight | 607.60 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-2-methyl-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]benzamide |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC(=C2)F)C(F)(F)F)C(=O)NC3=CN=C(N=C3)NC4=CC=C(C=C4)N5CCN(CC5)C |
| InChI | InChI=1S/C31H29F4N7O2/c1-19-3-4-24(38-28(43)20-13-21(31(33,34)35)15-22(32)14-20)16-27(19)29(44)39-25-17-36-30(37-18-25)40-23-5-7-26(8-6-23)42-11-9-41(2)10-12-42/h3-8,13-18H,9-12H2,1-2H3,(H,38,43)(H,39,44)(H,36,37,40) |
| InChIKey | JIMJOFDKLFAAOU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | 950 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|