About 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene
3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene (PubChem CID 161182129) has the molecular formula C23H48O2
and a molecular weight of 356.64 g/mol. Its IUPAC name is 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene.
Molecular Properties
| Compound Name | 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene |
| PubChem CID | 161182129 |
| Molecular Formula | C23H48O2 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.37 |
| IUPAC Name | 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene |
| SMILES | C=CC.CCCCCCCCC(CCC)(OC)C(CC)(CC)OCC |
| InChI | InChI=1S/C20H42O2.C3H6/c1-7-12-13-14-15-16-18-20(21-6,17-8-2)19(9-3,10-4)22-11-5;1-3-2/h7-18H2,1-6H3;3H,1H2,2H3 |
| InChIKey | USPGQTSEDNIZDA-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene?
The IUPAC name of 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene (CID 161182129) is 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene.
What is the SMILES notation for 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene?
The canonical SMILES for 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene is C=CC.CCCCCCCCC(CCC)(OC)C(CC)(CC)OCC.
What is the InChIKey of 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene?
The InChIKey is USPGQTSEDNIZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O2.C3H6/c1-7-12-13-14-15-16-18-20(21-6,17-8-2)19(9-3,10-4)22-11-5;1-3-2/h7-18H2,1-6H3;3H,1H2,2H3.
What are the key properties of 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene?
3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene has a molecular weight of 356.64 g/mol, XLogP of 7.71, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-3-ethyl-4-methoxy-4-propyldodecane;prop-1-ene is sourced from PubChem (CID 161182129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).