About 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid
2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid (PubChem CID 161182783) has the molecular formula C14H24N2O5
and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid |
| PubChem CID | 161182783 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCN(C)C.C=CC(=O)O.C=CC(N)=O |
| InChI | InChI=1S/C8H15NO2.C3H5NO.C3H4O2/c1-7(2)8(10)11-6-5-9(3)4;2*1-2-3(4)5/h1,5-6H2,2-4H3;2H,1H2,(H2,4,5);2H,1H2,(H,4,5) |
| InChIKey | USRNRMAJRYMRJD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid?
The IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid (CID 161182783) is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid is C=C(C)C(=O)OCCN(C)C.C=CC(=O)O.C=CC(N)=O.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid?
The InChIKey is USRNRMAJRYMRJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C3H5NO.C3H4O2/c1-7(2)8(10)11-6-5-9(3)4;2*1-2-3(4)5/h1,5-6H2,2-4H3;2H,1H2,(H2,4,5);2H,1H2,(H,4,5).
What are the key properties of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid?
2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid has a molecular weight of 300.36 g/mol, XLogP of 0.58, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;prop-2-enamide;prop-2-enoic acid is sourced from PubChem (CID 161182783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).