About 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile
4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile (PubChem CID 161182975) has the molecular formula C18H11N3O2S
and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile |
| PubChem CID | 161182975 |
| Molecular Formula | C18H11N3O2S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1.N#Cc1ccsc1 |
| InChI | InChI=1S/C13H8N2O2.C5H3NS/c14-9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)15(16)17;6-3-5-1-2-7-4-5/h1-8H;1-2,4H |
| InChIKey | USSHASHGXNPEMK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 90.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile?
The IUPAC name of 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile (CID 161182975) is 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile.
What is the SMILES notation for 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile?
The canonical SMILES for 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile is N#Cc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1.N#Cc1ccsc1.
What is the InChIKey of 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile?
The InChIKey is USSHASHGXNPEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2.C5H3NS/c14-9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)15(16)17;6-3-5-1-2-7-4-5/h1-8H;1-2,4H.
What are the key properties of 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile?
4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile has a molecular weight of 333.37 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-nitrophenyl)benzonitrile;thiophene-3-carbonitrile is sourced from PubChem (CID 161182975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).