C44H32N6O7 — CID 161183441
2-benzofuran-1,3-dione;4-phenylmethoxy-1H-indazol-3-amine;2-(4-phenylmethoxy-1H-indazol-3-yl)isoindole-1,3-dione (PubChem CID 161183441) has the molecular formula C44H32N6O7 and a molecular weight of 756.78 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;4-phenylmethoxy-1H-indazol-3-amine;2-(4-phenylmethoxy-1H-indazol-3-yl)isoindole-1,3-dione.
| Compound Name | 2-benzofuran-1,3-dione;4-phenylmethoxy-1H-indazol-3-amine;2-(4-phenylmethoxy-1H-indazol-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 161183441 |
| Molecular Formula | C44H32N6O7 |
| Molecular Weight | 756.78 g/mol |
| Exact Mass | 756.23 |
| IUPAC Name | 2-benzofuran-1,3-dione;4-phenylmethoxy-1H-indazol-3-amine;2-(4-phenylmethoxy-1H-indazol-3-yl)isoindole-1,3-dione |
| SMILES | Nc1n[nH]c2cccc(OCc3ccccc3)c12.O=C1OC(=O)c2ccccc21.O=C1c2ccccc2C(=O)N1c1n[nH]c2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C22H15N3O3.C14H13N3O.C8H4O3/c26-21-15-9-4-5-10-16(15)22(27)25(21)20-19-17(23-24-20)11-6-12-18(19)28-13-14-7-2-1-3-8-14;15-14-13-11(16-17-14)7-4-8-12(13)18-9-10-5-2-1-3-6-10;9-7-5-3-1-2-4-6(5)8(10)11-7/h1-12H,13H2,(H,23,24);1-8H,9H2,(H3,15,16,17);1-4H |
| InChIKey | USTVCABQCUGFBL-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 182.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.78 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|