C30H16Br4F12 — CID 161183668
1-bromo-3-[2-(3-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene;1-bromo-4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene (PubChem CID 161183668) has the molecular formula C30H16Br4F12 and a molecular weight of 924.05 g/mol. Its IUPAC name is 1-bromo-3-[2-(3-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene;1-bromo-4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene.
| Compound Name | 1-bromo-3-[2-(3-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene;1-bromo-4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene |
|---|---|
| PubChem CID | 161183668 |
| Molecular Formula | C30H16Br4F12 |
| Molecular Weight | 924.05 g/mol |
| Exact Mass | 919.78 |
| IUPAC Name | 1-bromo-3-[2-(3-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene;1-bromo-4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene |
| SMILES | FC(F)(F)C(c1ccc(Br)cc1)(c1ccc(Br)cc1)C(F)(F)F.FC(F)(F)C(c1cccc(Br)c1)(c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/2C15H8Br2F6/c16-11-5-1-9(2-6-11)13(14(18,19)20,15(21,22)23)10-3-7-12(17)8-4-10;16-11-5-1-3-9(7-11)13(14(18,19)20,15(21,22)23)10-4-2-6-12(17)8-10/h2*1-8H |
| InChIKey | USUPBRNACHNMMD-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.05 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |