About carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine
carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine (PubChem CID 161184491) has the molecular formula C10H27CoNP2
and a molecular weight of 282.21 g/mol. Its IUPAC name is carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine.
Molecular Properties
| Compound Name | carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine |
| PubChem CID | 161184491 |
| Molecular Formula | C10H27CoNP2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine |
| SMILES | CP(C)CCNCCP(C)C.[CH3-].[CH3-].[Co+2] |
| InChI | InChI=1S/C8H21NP2.2CH3.Co/c1-10(2)7-5-9-6-8-11(3)4;;;/h9H,5-8H2,1-4H3;2*1H3;/q;2*-1;+2 |
| InChIKey | USXDCGGQBFGVCW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine?
The IUPAC name of carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine (CID 161184491) is carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine.
What is the SMILES notation for carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine?
The canonical SMILES for carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine is CP(C)CCNCCP(C)C.[CH3-].[CH3-].[Co+2].
What is the InChIKey of carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine?
The InChIKey is USXDCGGQBFGVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21NP2.2CH3.Co/c1-10(2)7-5-9-6-8-11(3)4;;;/h9H,5-8H2,1-4H3;2*1H3;/q;2*-1;+2.
What are the key properties of carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine?
carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine has a molecular weight of 282.21 g/mol, XLogP of 2.96, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;cobalt(2+);2-dimethylphosphanyl-N-(2-dimethylphosphanylethyl)ethanamine is sourced from PubChem (CID 161184491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).