About 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone
4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone (PubChem CID 161185145) has the molecular formula C31H29FO5
and a molecular weight of 500.57 g/mol. Its IUPAC name is 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone |
| PubChem CID | 161185145 |
| Molecular Formula | C31H29FO5 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone |
| SMILES | CC(CCC(=O)O)(c1ccc(O)cc1)c1ccc(O)cc1.Cc1ccc(C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H18O4.C14H11FO/c1-17(11-10-16(20)21,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13;1-10-2-4-11(5-3-10)14(16)12-6-8-13(15)9-7-12/h2-9,18-19H,10-11H2,1H3,(H,20,21);2-9H,1H3 |
| InChIKey | USZHQNJROKXKJY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone?
The IUPAC name of 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone (CID 161185145) is 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone.
What is the SMILES notation for 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone?
The canonical SMILES for 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone is CC(CCC(=O)O)(c1ccc(O)cc1)c1ccc(O)cc1.Cc1ccc(C(=O)c2ccc(F)cc2)cc1.
What is the InChIKey of 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone?
The InChIKey is USZHQNJROKXKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O4.C14H11FO/c1-17(11-10-16(20)21,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13;1-10-2-4-11(5-3-10)14(16)12-6-8-13(15)9-7-12/h2-9,18-19H,10-11H2,1H3,(H,20,21);2-9H,1H3.
What are the key properties of 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone?
4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone has a molecular weight of 500.57 g/mol, XLogP of 6.63, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-bis(4-hydroxyphenyl)pentanoic acid;(4-fluorophenyl)-(4-methylphenyl)methanone is sourced from PubChem (CID 161185145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).