C11H16BN5O3 — CID 161186645
(2S,5R)-6-iminoboranyloxy-2-(5-propyl-1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 161186645) has the molecular formula C11H16BN5O3 and a molecular weight of 277.09 g/mol. Its IUPAC name is (2S,5R)-6-iminoboranyloxy-2-(5-propyl-1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-6-iminoboranyloxy-2-(5-propyl-1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 161186645 |
| Molecular Formula | C11H16BN5O3 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (2S,5R)-6-iminoboranyloxy-2-(5-propyl-1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | [H]/N=B/ON1C(=O)N2C[C@H]1CC[C@H]2c1nnc(CCC)o1 |
| InChI | InChI=1S/C11H16BN5O3/c1-2-3-9-14-15-10(19-9)8-5-4-7-6-16(8)11(18)17(7)20-12-13/h7-8,13H,2-6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | RJJZMQQYVQFPLR-SFYZADRCSA-N |
| XLogP | 1.28 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|