C15H12N2O2 — CID 161186979
2-(4-methoxyphenyl)-6H-1,6-naphthyridin-5-one (PubChem CID 161186979) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6H-1,6-naphthyridin-5-one.
| Compound Name | 2-(4-methoxyphenyl)-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 161186979 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-(4-methoxyphenyl)-6H-1,6-naphthyridin-5-one |
| SMILES | COc1ccc(-c2ccc3c(=O)[nH]ccc3n2)cc1 |
| InChI | InChI=1S/C15H12N2O2/c1-19-11-4-2-10(3-5-11)13-7-6-12-14(17-13)8-9-16-15(12)18/h2-9H,1H3,(H,16,18) |
| InChIKey | UTFCVIQQCIUCNA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |