C13H15F6NO5S — CID 161187142
trifluoromethanesulfonate;(1,1,2-trifluoro-2H-pyridin-1-ium-4-yl) cyclohexanecarboxylate (PubChem CID 161187142) has the molecular formula C13H15F6NO5S and a molecular weight of 411.32 g/mol. Its IUPAC name is trifluoromethanesulfonate;(1,1,2-trifluoro-2H-pyridin-1-ium-4-yl) cyclohexanecarboxylate.
| Compound Name | trifluoromethanesulfonate;(1,1,2-trifluoro-2H-pyridin-1-ium-4-yl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 161187142 |
| Molecular Formula | C13H15F6NO5S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | trifluoromethanesulfonate;(1,1,2-trifluoro-2H-pyridin-1-ium-4-yl) cyclohexanecarboxylate |
| SMILES | O=C(OC1=CC(F)[N+](F)(F)C=C1)C1CCCCC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C12H15F3NO2.CHF3O3S/c13-11-8-10(6-7-16(11,14)15)18-12(17)9-4-2-1-3-5-9;2-1(3,4)8(5,6)7/h6-9,11H,1-5H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | UTFQBMNQGVYJGX-UHFFFAOYSA-M |
| XLogP | 3.45 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|