About 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine
3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine (PubChem CID 161187726) has the molecular formula C15H13N3
and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine.
Molecular Properties
| Compound Name | 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine |
| PubChem CID | 161187726 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine |
| SMILES | Cc1cc2cc(-c3cnccc3C)ncc2cn1 |
| InChI | InChI=1S/C15H13N3/c1-10-3-4-16-9-14(10)15-6-12-5-11(2)17-7-13(12)8-18-15/h3-9H,1-2H3 |
| InChIKey | UTHPJWKZIFDHFH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine?
The IUPAC name of 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine (CID 161187726) is 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine.
What is the SMILES notation for 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine?
The canonical SMILES for 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine is Cc1cc2cc(-c3cnccc3C)ncc2cn1.
What is the InChIKey of 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine?
The InChIKey is UTHPJWKZIFDHFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3/c1-10-3-4-16-9-14(10)15-6-12-5-11(2)17-7-13(12)8-18-15/h3-9H,1-2H3.
What are the key properties of 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine?
3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine has a molecular weight of 235.29 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-(4-methyl-3-pyridinyl)-2,7-naphthyridine is sourced from PubChem (CID 161187726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).