C29H42N6O4 — CID 161187960
1-[3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[3,2-c]pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 161187960) has the molecular formula C29H42N6O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is 1-[3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[3,2-c]pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[3,2-c]pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 161187960 |
| Molecular Formula | C29H42N6O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | 1-[3-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[3,2-c]pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)N(CCCNC(=O)Nc1ccc(C(C)(C)C)cc1)C[C@H]1O[C@@H](n2ccc3c(N)nccc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H42N6O4/c1-18(2)34(15-6-13-32-28(38)33-20-9-7-19(8-10-20)29(3,4)5)17-23-24(36)25(37)27(39-23)35-16-12-21-22(35)11-14-31-26(21)30/h7-12,14,16,18,23-25,27,36-37H,6,13,15,17H2,1-5H3,(H2,30,31)(H2,32,33,38)/t23-,24-,25-,27-/m1/s1 |
| InChIKey | UTIKHMCIFUDRGA-DLGLWYJGSA-N |
| XLogP | 3.46 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|