About CID 161188629
CID 161188629 (PubChem CID 161188629) has the molecular formula C37H33BN5O2
and a molecular weight of 590.52 g/mol.
Molecular Properties
| Compound Name | CID 161188629 |
| PubChem CID | 161188629 |
| Molecular Formula | C37H33BN5O2 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | — |
| SMILES | O=C[B]CC1CCN(Cc2ccc3cncc(-c4ccccc4)c3n2)CC1.O=Cc1ccc2cncc(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H23BN3O.C15H10N2O/c27-16-23-12-17-8-10-26(11-9-17)15-20-7-6-19-13-24-14-21(22(19)25-20)18-4-2-1-3-5-18;18-10-13-7-6-12-8-16-9-14(15(12)17-13)11-4-2-1-3-5-11/h1-7,13-14,16-17H,8-12,15H2;1-10H |
| InChIKey | XJKPHYFDTQZJTK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 88.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161188629 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161188629?
The IUPAC name of CID 161188629 (CID 161188629) is not available.
What is the SMILES notation for CID 161188629?
The canonical SMILES for CID 161188629 is O=C[B]CC1CCN(Cc2ccc3cncc(-c4ccccc4)c3n2)CC1.O=Cc1ccc2cncc(-c3ccccc3)c2n1.
What is the InChIKey of CID 161188629?
The InChIKey is XJKPHYFDTQZJTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23BN3O.C15H10N2O/c27-16-23-12-17-8-10-26(11-9-17)15-20-7-6-19-13-24-14-21(22(19)25-20)18-4-2-1-3-5-18;18-10-13-7-6-12-8-16-9-14(15(12)17-13)11-4-2-1-3-5-11/h1-7,13-14,16-17H,8-12,15H2;1-10H.
What are the key properties of CID 161188629?
CID 161188629 has a molecular weight of 590.52 g/mol, XLogP of 6.93, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161188629 is sourced from PubChem (CID 161188629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).