About 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane
3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane (PubChem CID 161190033) has the molecular formula C21H26Cl2N2O2
and a molecular weight of 409.36 g/mol. Its IUPAC name is 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane.
Molecular Properties
| Compound Name | 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane |
| PubChem CID | 161190033 |
| Molecular Formula | C21H26Cl2N2O2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane |
| SMILES | C.Cc1c(Cl)ccc2c(=O)cc(OC(C)C)[nH]c12.Cc1c(N)cccc1Cl |
| InChI | InChI=1S/C13H14ClNO2.C7H8ClN.CH4/c1-7(2)17-12-6-11(16)9-4-5-10(14)8(3)13(9)15-12;1-5-6(8)3-2-4-7(5)9;/h4-7H,1-3H3,(H,15,16);2-4H,9H2,1H3;1H4 |
| InChIKey | UTPAXTGSSBWOGN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane?
The IUPAC name of 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane (CID 161190033) is 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane.
What is the SMILES notation for 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane?
The canonical SMILES for 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane is C.Cc1c(Cl)ccc2c(=O)cc(OC(C)C)[nH]c12.Cc1c(N)cccc1Cl.
What is the InChIKey of 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane?
The InChIKey is UTPAXTGSSBWOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO2.C7H8ClN.CH4/c1-7(2)17-12-6-11(16)9-4-5-10(14)8(3)13(9)15-12;1-5-6(8)3-2-4-7(5)9;/h4-7H,1-3H3,(H,15,16);2-4H,9H2,1H3;1H4.
What are the key properties of 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane?
3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane has a molecular weight of 409.36 g/mol, XLogP of 6.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-methylaniline;7-chloro-8-methyl-2-propan-2-yloxy-1H-quinolin-4-one;methane is sourced from PubChem (CID 161190033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).