About methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole
methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole (PubChem CID 161190868) has the molecular formula C14H30N4O
and a molecular weight of 270.42 g/mol. Its IUPAC name is methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole.
Molecular Properties
| Compound Name | methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole |
| PubChem CID | 161190868 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole |
| SMILES | C.CC(C)NC1CCOCC1.CC(C)n1cnnc1 |
| InChI | InChI=1S/C8H17NO.C5H9N3.CH4/c1-7(2)9-8-3-5-10-6-4-8;1-5(2)8-3-6-7-4-8;/h7-9H,3-6H2,1-2H3;3-5H,1-2H3;1H4 |
| InChIKey | UTRXUZLDNCWZHS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole?
The IUPAC name of methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole (CID 161190868) is methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole.
What is the SMILES notation for methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole?
The canonical SMILES for methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole is C.CC(C)NC1CCOCC1.CC(C)n1cnnc1.
What is the InChIKey of methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole?
The InChIKey is UTRXUZLDNCWZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C5H9N3.CH4/c1-7(2)9-8-3-5-10-6-4-8;1-5(2)8-3-6-7-4-8;/h7-9H,3-6H2,1-2H3;3-5H,1-2H3;1H4.
What are the key properties of methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole?
methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole has a molecular weight of 270.42 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-propan-2-yloxan-4-amine;4-propan-2-yl-1,2,4-triazole is sourced from PubChem (CID 161190868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).