C26H28F6N4O4 — CID 161190936
1-(7-amino-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone;1-(4,4-dimethyl-7-nitro-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone (PubChem CID 161190936) has the molecular formula C26H28F6N4O4 and a molecular weight of 574.52 g/mol. Its IUPAC name is 1-(7-amino-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone;1-(4,4-dimethyl-7-nitro-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(7-amino-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone;1-(4,4-dimethyl-7-nitro-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 161190936 |
| Molecular Formula | C26H28F6N4O4 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | 1-(7-amino-4,4-dimethyl-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone;1-(4,4-dimethyl-7-nitro-1,3-dihydroisoquinolin-2-yl)-2,2,2-trifluoroethanone |
| SMILES | CC1(C)CN(C(=O)C(F)(F)F)Cc2cc(N)ccc21.CC1(C)CN(C(=O)C(F)(F)F)Cc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H13F3N2O3.C13H15F3N2O/c1-12(2)7-17(11(19)13(14,15)16)6-8-5-9(18(20)21)3-4-10(8)12;1-12(2)7-18(11(19)13(14,15)16)6-8-5-9(17)3-4-10(8)12/h3-5H,6-7H2,1-2H3;3-5H,6-7,17H2,1-2H3 |
| InChIKey | UTSDEUYQDHTWDK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|