About 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide
3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide (PubChem CID 161191303) has the molecular formula C13H12Cl2N4O6S
and a molecular weight of 423.23 g/mol. Its IUPAC name is 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide |
| PubChem CID | 161191303 |
| Molecular Formula | C13H12Cl2N4O6S |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc([N+](=O)[O-])c(Cl)c1.Nc1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C7H7ClN2O4S.C6H5ClN2O2/c1-15(13,14)9-5-2-3-7(10(11)12)6(8)4-5;7-5-3-4(8)1-2-6(5)9(10)11/h2-4,9H,1H3;1-3H,8H2 |
| InChIKey | UTTJXYWNXYXZJI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide?
The IUPAC name of 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide (CID 161191303) is 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide.
What is the SMILES notation for 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide?
The canonical SMILES for 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide is CS(=O)(=O)Nc1ccc([N+](=O)[O-])c(Cl)c1.Nc1ccc([N+](=O)[O-])c(Cl)c1.
What is the InChIKey of 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide?
The InChIKey is UTTJXYWNXYXZJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O4S.C6H5ClN2O2/c1-15(13,14)9-5-2-3-7(10(11)12)6(8)4-5;7-5-3-4(8)1-2-6(5)9(10)11/h2-4,9H,1H3;1-3H,8H2.
What are the key properties of 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide?
3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide has a molecular weight of 423.23 g/mol, XLogP of 3.45, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-nitroaniline;N-(3-chloro-4-nitrophenyl)methanesulfonamide is sourced from PubChem (CID 161191303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).