C12H16N4O — CID 161192615
6-propan-2-yl-1,5,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one (PubChem CID 161192615) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 6-propan-2-yl-1,5,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one.
| Compound Name | 6-propan-2-yl-1,5,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one |
|---|---|
| PubChem CID | 161192615 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 6-propan-2-yl-1,5,8,11-tetrazatricyclo[7.4.0.03,7]trideca-3(7),5,8-trien-2-one |
| SMILES | CC(C)C1=NCc2c1nc1n(c2=O)CCNC1 |
| InChI | InChI=1S/C12H16N4O/c1-7(2)10-11-8(5-14-10)12(17)16-4-3-13-6-9(16)15-11/h7,13H,3-6H2,1-2H3 |
| InChIKey | UTXSGNBSPXNPIY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |